C21H18N5O3S — CID 135981041
CID 135981041 (PubChem CID 135981041) has the molecular formula C21H18N5O3S and a molecular weight of 420.47 g/mol.
| Compound Name | CID 135981041 |
|---|---|
| PubChem CID | 135981041 |
| Molecular Formula | C21H18N5O3S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | — |
| SMILES | [NH]S(=O)(=O)c1ccc(/N=N/c2c(O)[nH]c3cccc(CCc4ccncc4)c23)cc1 |
| InChI | InChI=1S/C21H18N5O3S/c22-30(28,29)17-8-6-16(7-9-17)25-26-20-19-15(2-1-3-18(19)24-21(20)27)5-4-14-10-12-23-13-11-14/h1-3,6-13,22,24,27H,4-5H2/b26-25+ |
| InChIKey | QCEVQLVHTNRSAF-OCEACIFDSA-N |
| XLogP | 4.44 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|