C24H27N2O3S+ — CID 135982722
(E)-3-(4-tert-butylphenyl)-N-(furan-2-ylmethyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]prop-2-enethioamide (PubChem CID 135982722) has the molecular formula C24H27N2O3S+ and a molecular weight of 423.56 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-(furan-2-ylmethyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]prop-2-enethioamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-(furan-2-ylmethyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]prop-2-enethioamide |
|---|---|
| PubChem CID | 135982722 |
| Molecular Formula | C24H27N2O3S+ |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-(furan-2-ylmethyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]prop-2-enethioamide |
| SMILES | CC(C)(C)c1ccc(/C(O)=C(/C(=S)NCc2ccco2)[n+]2cccc(CO)c2)cc1 |
| InChI | InChI=1S/C24H26N2O3S/c1-24(2,3)19-10-8-18(9-11-19)22(28)21(26-12-4-6-17(15-26)16-27)23(30)25-14-20-7-5-13-29-20/h4-13,15,27H,14,16H2,1-3H3,(H-,25,28,30)/p+1 |
| InChIKey | CJEQXZQPRQURBD-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|