C19H16ClN2O2S+ — CID 135982805
(E)-3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135982805) has the molecular formula C19H16ClN2O2S+ and a molecular weight of 371.87 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135982805 |
| Molecular Formula | C19H16ClN2O2S+ |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | O/C(=C(\C(=S)NCc1ccco1)[n+]1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN2O2S/c20-15-8-6-14(7-9-15)18(23)17(22-10-2-1-3-11-22)19(25)21-13-16-5-4-12-24-16/h1-12H,13H2,(H-,21,23,25)/p+1 |
| InChIKey | ZMZYZOFHJIGWGI-UHFFFAOYSA-O |
| XLogP | 4.22 |
| TPSA | 49.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|