C21H26N4O8S — CID 135984094
[5-[[amino-(methoxycarbonylamino)methylidene]amino]-2-[(2-methoxyacetyl)amino]phenyl] 3-propoxybenzenesulfonate (PubChem CID 135984094) has the molecular formula C21H26N4O8S and a molecular weight of 494.53 g/mol. Its IUPAC name is [5-[[amino-(methoxycarbonylamino)methylidene]amino]-2-[(2-methoxyacetyl)amino]phenyl] 3-propoxybenzenesulfonate.
| Compound Name | [5-[[amino-(methoxycarbonylamino)methylidene]amino]-2-[(2-methoxyacetyl)amino]phenyl] 3-propoxybenzenesulfonate |
|---|---|
| PubChem CID | 135984094 |
| Molecular Formula | C21H26N4O8S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [5-[[amino-(methoxycarbonylamino)methylidene]amino]-2-[(2-methoxyacetyl)amino]phenyl] 3-propoxybenzenesulfonate |
| SMILES | CCCOc1cccc(S(=O)(=O)Oc2cc(/N=C(\N)NC(=O)OC)ccc2NC(=O)COC)c1 |
| InChI | InChI=1S/C21H26N4O8S/c1-4-10-32-15-6-5-7-16(12-15)34(28,29)33-18-11-14(23-20(22)25-21(27)31-3)8-9-17(18)24-19(26)13-30-2/h5-9,11-12H,4,10,13H2,1-3H3,(H,24,26)(H3,22,23,25,27) |
| InChIKey | LUUGIJDQMSFKRN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 167.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|