C20H24N4O6S — CID 135711176
[3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-(pentanoylamino)phenyl] benzenesulfonate (PubChem CID 135711176) has the molecular formula C20H24N4O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is [3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-(pentanoylamino)phenyl] benzenesulfonate.
| Compound Name | [3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-(pentanoylamino)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 135711176 |
| Molecular Formula | C20H24N4O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | [3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-(pentanoylamino)phenyl] benzenesulfonate |
| SMILES | CCCCC(=O)Nc1ccc(OS(=O)(=O)c2ccccc2)cc1/N=C(\N)NC(=O)OC |
| InChI | InChI=1S/C20H24N4O6S/c1-3-4-10-18(25)22-16-12-11-14(13-17(16)23-19(21)24-20(26)29-2)30-31(27,28)15-8-6-5-7-9-15/h5-9,11-13H,3-4,10H2,1-2H3,(H,22,25)(H3,21,23,24,26) |
| InChIKey | DYALAEHIWFZFKL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|