C18H20N4O7S — CID 135711164
phenyl 3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-[(2-methoxyacetyl)amino]benzenesulfonate (PubChem CID 135711164) has the molecular formula C18H20N4O7S and a molecular weight of 436.45 g/mol. Its IUPAC name is phenyl 3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-[(2-methoxyacetyl)amino]benzenesulfonate.
| Compound Name | phenyl 3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-[(2-methoxyacetyl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 135711164 |
| Molecular Formula | C18H20N4O7S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | phenyl 3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-[(2-methoxyacetyl)amino]benzenesulfonate |
| SMILES | COCC(=O)Nc1ccc(S(=O)(=O)Oc2ccccc2)cc1/N=C(\N)NC(=O)OC |
| InChI | InChI=1S/C18H20N4O7S/c1-27-11-16(23)20-14-9-8-13(10-15(14)21-17(19)22-18(24)28-2)30(25,26)29-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H,20,23)(H3,19,21,22,24) |
| InChIKey | PNFPOZXMIJROCV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|