C19H19F3N4O7S — CID 135711171
[3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-[(2-methoxyacetyl)amino]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 135711171) has the molecular formula C19H19F3N4O7S and a molecular weight of 504.44 g/mol. Its IUPAC name is [3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-[(2-methoxyacetyl)amino]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-[(2-methoxyacetyl)amino]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 135711171 |
| Molecular Formula | C19H19F3N4O7S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | [3-[[amino-(methoxycarbonylamino)methylidene]amino]-4-[(2-methoxyacetyl)amino]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCC(=O)Nc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1/N=C(\N)NC(=O)OC |
| InChI | InChI=1S/C19H19F3N4O7S/c1-31-10-16(27)24-14-7-6-12(9-15(14)25-17(23)26-18(28)32-2)33-34(29,30)13-5-3-4-11(8-13)19(20,21)22/h3-9H,10H2,1-2H3,(H,24,27)(H3,23,25,26,28) |
| InChIKey | MRGHYNUEFMFXHF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|