C25H26N4O7S — CID 88786539
[5-[(N'-benzyl-N-methoxycarbonylcarbamimidoyl)amino]-2-[(2-methoxyacetyl)amino]phenyl] benzenesulfonate (PubChem CID 88786539) has the molecular formula C25H26N4O7S and a molecular weight of 526.57 g/mol. Its IUPAC name is [5-[(N'-benzyl-N-methoxycarbonylcarbamimidoyl)amino]-2-[(2-methoxyacetyl)amino]phenyl] benzenesulfonate.
| Compound Name | [5-[(N'-benzyl-N-methoxycarbonylcarbamimidoyl)amino]-2-[(2-methoxyacetyl)amino]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 88786539 |
| Molecular Formula | C25H26N4O7S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [5-[(N'-benzyl-N-methoxycarbonylcarbamimidoyl)amino]-2-[(2-methoxyacetyl)amino]phenyl] benzenesulfonate |
| SMILES | COCC(=O)Nc1ccc(N/C(=N/Cc2ccccc2)NC(=O)OC)cc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26N4O7S/c1-34-17-23(30)28-21-14-13-19(15-22(21)36-37(32,33)20-11-7-4-8-12-20)27-24(29-25(31)35-2)26-16-18-9-5-3-6-10-18/h3-15H,16-17H2,1-2H3,(H,28,30)(H2,26,27,29,31) |
| InChIKey | CBHNGTGQVJDBLX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|