C10H12N4O5S — CID 135987381
2-[(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)methoxy]ethyl acetate (PubChem CID 135987381) has the molecular formula C10H12N4O5S and a molecular weight of 300.30 g/mol. Its IUPAC name is 2-[(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)methoxy]ethyl acetate.
| Compound Name | 2-[(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 135987381 |
| Molecular Formula | C10H12N4O5S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1c(=O)sc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H12N4O5S/c1-5(15)19-3-2-18-4-14-7-6(20-10(14)17)8(16)13-9(11)12-7/h2-4H2,1H3,(H3,11,12,13,16) |
| InChIKey | NSKZYAXYZDEZRU-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|