About 2-amino-3-iodopyridin-4-ol;yttrium;nitrite
2-amino-3-iodopyridin-4-ol;yttrium;nitrite (PubChem CID 135989939) has the molecular formula C5H5IN3O3Y-
and a molecular weight of 370.92 g/mol. Its IUPAC name is 2-amino-3-iodopyridin-4-ol;yttrium;nitrite.
Molecular Properties
| Compound Name | 2-amino-3-iodopyridin-4-ol;yttrium;nitrite |
| PubChem CID | 135989939 |
| Molecular Formula | C5H5IN3O3Y- |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.84 |
| IUPAC Name | 2-amino-3-iodopyridin-4-ol;yttrium;nitrite |
| SMILES | Nc1nccc(O)c1I.O=N[O-].[Y] |
| InChI | InChI=1S/C5H5IN2O.HNO2.Y/c6-4-3(9)1-2-8-5(4)7;2-1-3;/h1-2H,(H3,7,8,9);(H,2,3);/p-1 |
| InChIKey | RGDXNSBQJCEEEG-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-iodopyridin-4-ol;yttrium;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-iodopyridin-4-ol;yttrium;nitrite?
The IUPAC name of 2-amino-3-iodopyridin-4-ol;yttrium;nitrite (CID 135989939) is 2-amino-3-iodopyridin-4-ol;yttrium;nitrite.
What is the SMILES notation for 2-amino-3-iodopyridin-4-ol;yttrium;nitrite?
The canonical SMILES for 2-amino-3-iodopyridin-4-ol;yttrium;nitrite is Nc1nccc(O)c1I.O=N[O-].[Y].
What is the InChIKey of 2-amino-3-iodopyridin-4-ol;yttrium;nitrite?
The InChIKey is RGDXNSBQJCEEEG-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5IN2O.HNO2.Y/c6-4-3(9)1-2-8-5(4)7;2-1-3;/h1-2H,(H3,7,8,9);(H,2,3);/p-1.
What are the key properties of 2-amino-3-iodopyridin-4-ol;yttrium;nitrite?
2-amino-3-iodopyridin-4-ol;yttrium;nitrite has a molecular weight of 370.92 g/mol, XLogP of 1.22, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-iodopyridin-4-ol;yttrium;nitrite is sourced from PubChem (CID 135989939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).