2-aminopyridin-3-ol;sulfuric acid

C5H8N2O5S — CID 67131253

IUPAC2-aminopyridin-3-ol;sulfuric acid
SMILESNc1ncccc1O.O=S(=O)(O)O
InChIInChI=1S/C5H6N2O.H2O4S/c6-5-4(8)2-1-3-7-5;1-5(2,3)4/h1-3,8H,(H2,6,7);(H2,1,2,3,4)
InChIKeyJZWBLWZYCQRNKB-UHFFFAOYSA-N
MW208.19 g/mol
LogP-0.28
Rot. Bonds

About 2-aminopyridin-3-ol;sulfuric acid

2-aminopyridin-3-ol;sulfuric acid (PubChem CID 67131253) has the molecular formula C5H8N2O5S and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-aminopyridin-3-ol;sulfuric acid.

Molecular Properties

Compound Name2-aminopyridin-3-ol;sulfuric acid
PubChem CID67131253
Molecular FormulaC5H8N2O5S
Molecular Weight208.19 g/mol
Exact Mass208.02
IUPAC Name2-aminopyridin-3-ol;sulfuric acid
SMILESNc1ncccc1O.O=S(=O)(O)O
InChIInChI=1S/C5H6N2O.H2O4S/c6-5-4(8)2-1-3-7-5;1-5(2,3)4/h1-3,8H,(H2,6,7);(H2,1,2,3,4)
InChIKeyJZWBLWZYCQRNKB-UHFFFAOYSA-N
XLogP-0.28
TPSA133.74 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.19
LogP ≤ 5-0.28
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-aminopyridin-3-ol;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminopyridin-3-ol;sulfuric acid?
The IUPAC name of 2-aminopyridin-3-ol;sulfuric acid (CID 67131253) is 2-aminopyridin-3-ol;sulfuric acid.
What is the SMILES notation for 2-aminopyridin-3-ol;sulfuric acid?
The canonical SMILES for 2-aminopyridin-3-ol;sulfuric acid is Nc1ncccc1O.O=S(=O)(O)O.
What is the InChIKey of 2-aminopyridin-3-ol;sulfuric acid?
The InChIKey is JZWBLWZYCQRNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.H2O4S/c6-5-4(8)2-1-3-7-5;1-5(2,3)4/h1-3,8H,(H2,6,7);(H2,1,2,3,4).
What are the key properties of 2-aminopyridin-3-ol;sulfuric acid?
2-aminopyridin-3-ol;sulfuric acid has a molecular weight of 208.19 g/mol, XLogP of -0.28, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopyridin-3-ol;sulfuric acid is sourced from PubChem (CID 67131253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).