About 2-aminopyridin-3-ol;sulfuric acid
2-aminopyridin-3-ol;sulfuric acid (PubChem CID 67131253) has the molecular formula C5H8N2O5S
and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-aminopyridin-3-ol;sulfuric acid.
Molecular Properties
| Compound Name | 2-aminopyridin-3-ol;sulfuric acid |
| PubChem CID | 67131253 |
| Molecular Formula | C5H8N2O5S |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 2-aminopyridin-3-ol;sulfuric acid |
| SMILES | Nc1ncccc1O.O=S(=O)(O)O |
| InChI | InChI=1S/C5H6N2O.H2O4S/c6-5-4(8)2-1-3-7-5;1-5(2,3)4/h1-3,8H,(H2,6,7);(H2,1,2,3,4) |
| InChIKey | JZWBLWZYCQRNKB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopyridin-3-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopyridin-3-ol;sulfuric acid?
The IUPAC name of 2-aminopyridin-3-ol;sulfuric acid (CID 67131253) is 2-aminopyridin-3-ol;sulfuric acid.
What is the SMILES notation for 2-aminopyridin-3-ol;sulfuric acid?
The canonical SMILES for 2-aminopyridin-3-ol;sulfuric acid is Nc1ncccc1O.O=S(=O)(O)O.
What is the InChIKey of 2-aminopyridin-3-ol;sulfuric acid?
The InChIKey is JZWBLWZYCQRNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.H2O4S/c6-5-4(8)2-1-3-7-5;1-5(2,3)4/h1-3,8H,(H2,6,7);(H2,1,2,3,4).
What are the key properties of 2-aminopyridin-3-ol;sulfuric acid?
2-aminopyridin-3-ol;sulfuric acid has a molecular weight of 208.19 g/mol, XLogP of -0.28, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopyridin-3-ol;sulfuric acid is sourced from PubChem (CID 67131253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).