About 2-iodopyridin-3-ol;hydrochloride
2-iodopyridin-3-ol;hydrochloride (PubChem CID 141441787) has the molecular formula C5H5ClINO
and a molecular weight of 257.46 g/mol. Its IUPAC name is 2-iodopyridin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-iodopyridin-3-ol;hydrochloride |
| PubChem CID | 141441787 |
| Molecular Formula | C5H5ClINO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 256.91 |
| IUPAC Name | 2-iodopyridin-3-ol;hydrochloride |
| SMILES | Cl.Oc1cccnc1I |
| InChI | InChI=1S/C5H4INO.ClH/c6-5-4(8)2-1-3-7-5;/h1-3,8H;1H |
| InChIKey | KJABPXBLPBFZHH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodopyridin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodopyridin-3-ol;hydrochloride?
The IUPAC name of 2-iodopyridin-3-ol;hydrochloride (CID 141441787) is 2-iodopyridin-3-ol;hydrochloride.
What is the SMILES notation for 2-iodopyridin-3-ol;hydrochloride?
The canonical SMILES for 2-iodopyridin-3-ol;hydrochloride is Cl.Oc1cccnc1I.
What is the InChIKey of 2-iodopyridin-3-ol;hydrochloride?
The InChIKey is KJABPXBLPBFZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4INO.ClH/c6-5-4(8)2-1-3-7-5;/h1-3,8H;1H.
What are the key properties of 2-iodopyridin-3-ol;hydrochloride?
2-iodopyridin-3-ol;hydrochloride has a molecular weight of 257.46 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodopyridin-3-ol;hydrochloride is sourced from PubChem (CID 141441787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).