C9H11N5O2 — CID 135991969
3-amino-2,5,6,6a,7,8-hexahydropyrrolo[1,2-f]pteridine-1,9-dione (PubChem CID 135991969) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 3-amino-2,5,6,6a,7,8-hexahydropyrrolo[1,2-f]pteridine-1,9-dione.
| Compound Name | 3-amino-2,5,6,6a,7,8-hexahydropyrrolo[1,2-f]pteridine-1,9-dione |
|---|---|
| PubChem CID | 135991969 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-amino-2,5,6,6a,7,8-hexahydropyrrolo[1,2-f]pteridine-1,9-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)N1C(=O)CCC1CN2 |
| InChI | InChI=1S/C9H11N5O2/c10-9-12-7-6(8(16)13-9)14-4(3-11-7)1-2-5(14)15/h4H,1-3H2,(H4,10,11,12,13,16) |
| InChIKey | FLXKLGYSMUUAKY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |