C9H13N5O2 — CID 136975919
5-amino-4-[(5-oxopyrrolidin-2-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136975919) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 5-amino-4-[(5-oxopyrrolidin-2-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[(5-oxopyrrolidin-2-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975919 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 5-amino-4-[(5-oxopyrrolidin-2-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCC2CCC(=O)N2)nc[nH]c1=O |
| InChI | InChI=1S/C9H13N5O2/c10-7-8(12-4-13-9(7)16)11-3-5-1-2-6(15)14-5/h4-5H,1-3,10H2,(H,14,15)(H2,11,12,13,16) |
| InChIKey | HXKPIOQAKROUFD-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |