C10H17N7O2 — CID 169130894
N-(4-amino-6-oxo-1H-pyrimidin-5-yl)-5-(diaminomethylideneamino)pentanamide (PubChem CID 169130894) has the molecular formula C10H17N7O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-(4-amino-6-oxo-1H-pyrimidin-5-yl)-5-(diaminomethylideneamino)pentanamide.
| Compound Name | N-(4-amino-6-oxo-1H-pyrimidin-5-yl)-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 169130894 |
| Molecular Formula | C10H17N7O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(4-amino-6-oxo-1H-pyrimidin-5-yl)-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(N)=NCCCCC(=O)Nc1c(N)nc[nH]c1=O |
| InChI | InChI=1S/C10H17N7O2/c11-8-7(9(19)16-5-15-8)17-6(18)3-1-2-4-14-10(12)13/h5H,1-4H2,(H,17,18)(H4,12,13,14)(H3,11,15,16,19) |
| InChIKey | ARNIAQMCBZOEIG-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 165.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|