C19H20N4O4S — CID 135993419
N-(2-hydroxy-1-methylindol-3-yl)imino-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 135993419) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-(2-hydroxy-1-methylindol-3-yl)imino-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-(2-hydroxy-1-methylindol-3-yl)imino-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 135993419 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-(2-hydroxy-1-methylindol-3-yl)imino-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)/N=N/c2c(O)n(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C19H20N4O4S/c1-13-8-10-14(11-9-13)28(26,27)22(2)12-17(24)20-21-18-15-6-4-5-7-16(15)23(3)19(18)25/h4-11,25H,12H2,1-3H3/b21-20+ |
| InChIKey | ISMVTUDQRBZUQI-QZQOTICOSA-N |
| XLogP | 3.12 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|