C24H21ClN4O4S — CID 137068604
2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-(2-hydroxy-1-methylindol-3-yl)iminoacetamide (PubChem CID 137068604) has the molecular formula C24H21ClN4O4S and a molecular weight of 496.98 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-(2-hydroxy-1-methylindol-3-yl)iminoacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-(2-hydroxy-1-methylindol-3-yl)iminoacetamide |
|---|---|
| PubChem CID | 137068604 |
| Molecular Formula | C24H21ClN4O4S |
| Molecular Weight | 496.98 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-(2-hydroxy-1-methylindol-3-yl)iminoacetamide |
| SMILES | Cc1ccc(N(CC(=O)/N=N/c2c(O)n(C)c3ccccc23)S(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H21ClN4O4S/c1-16-12-13-17(14-20(16)25)29(34(32,33)18-8-4-3-5-9-18)15-22(30)26-27-23-19-10-6-7-11-21(19)28(2)24(23)31/h3-14,31H,15H2,1-2H3/b27-26+ |
| InChIKey | JMAWHAIJIAVOHY-CYYJNZCTSA-N |
| XLogP | 5.35 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.98 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|