C18H17IN4O4S — CID 137149870
N-(2-hydroxy-1-methylindol-3-yl)imino-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 137149870) has the molecular formula C18H17IN4O4S and a molecular weight of 512.33 g/mol. Its IUPAC name is N-(2-hydroxy-1-methylindol-3-yl)imino-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(2-hydroxy-1-methylindol-3-yl)imino-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 137149870 |
| Molecular Formula | C18H17IN4O4S |
| Molecular Weight | 512.33 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | N-(2-hydroxy-1-methylindol-3-yl)imino-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | Cn1c(O)c(/N=N/C(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C18H17IN4O4S/c1-22-15-6-4-3-5-14(15)17(18(22)25)21-20-16(24)11-23(28(2,26)27)13-9-7-12(19)8-10-13/h3-10,25H,11H2,1-2H3/b21-20+ |
| InChIKey | KMGLZBQKLKRAAY-QZQOTICOSA-N |
| XLogP | 3.57 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|