C19H16ClF3N4O4S — CID 137068586
2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-hydroxy-1-methylindol-3-yl)iminoacetamide (PubChem CID 137068586) has the molecular formula C19H16ClF3N4O4S and a molecular weight of 488.88 g/mol. Its IUPAC name is 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-hydroxy-1-methylindol-3-yl)iminoacetamide.
| Compound Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-hydroxy-1-methylindol-3-yl)iminoacetamide |
|---|---|
| PubChem CID | 137068586 |
| Molecular Formula | C19H16ClF3N4O4S |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-hydroxy-1-methylindol-3-yl)iminoacetamide |
| SMILES | Cn1c(O)c(/N=N/C(=O)CN(c2ccc(Cl)c(C(F)(F)F)c2)S(C)(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C19H16ClF3N4O4S/c1-26-15-6-4-3-5-12(15)17(18(26)29)25-24-16(28)10-27(32(2,30)31)11-7-8-14(20)13(9-11)19(21,22)23/h3-9,29H,10H2,1-2H3/b25-24+ |
| InChIKey | PKIIQTKYTZETPP-OCOZRVBESA-N |
| XLogP | 4.63 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|