C22H19N5OS — CID 135994177
2-(2-methyl-2,3-dihydroindol-1-yl)-6-(3-methylphenyl)-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 135994177) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydroindol-1-yl)-6-(3-methylphenyl)-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 2-(2-methyl-2,3-dihydroindol-1-yl)-6-(3-methylphenyl)-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135994177 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(2-methyl-2,3-dihydroindol-1-yl)-6-(3-methylphenyl)-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | Cc1cccc(-n2cnc3nc(N4c5ccccc5CC4C)[nH]c(=O)c3c2=S)c1 |
| InChI | InChI=1S/C22H19N5OS/c1-13-6-5-8-16(10-13)26-12-23-19-18(21(26)29)20(28)25-22(24-19)27-14(2)11-15-7-3-4-9-17(15)27/h3-10,12,14H,11H2,1-2H3,(H,24,25,28) |
| InChIKey | LLAKKNZUUASORG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|