C23H21N5OS — CID 135994190
2-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-ethylphenyl)-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 135994190) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-ethylphenyl)-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-ethylphenyl)-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135994190 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-ethylphenyl)-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | CCc1ccc(-n2cnc3nc(N4CCc5ccccc5C4)[nH]c(=O)c3c2=S)cc1 |
| InChI | InChI=1S/C23H21N5OS/c1-2-15-7-9-18(10-8-15)28-14-24-20-19(22(28)30)21(29)26-23(25-20)27-12-11-16-5-3-4-6-17(16)13-27/h3-10,14H,2,11-13H2,1H3,(H,25,26,29) |
| InChIKey | LHZDNOOCZHTIJX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|