C23H21N5OS — CID 136875142
6-(4-ethylphenyl)-2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 136875142) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 6-(4-ethylphenyl)-2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136875142 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-(4-ethylphenyl)-2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-5-sulfanylidene-3H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | CCc1ccc(-n2cnc3nc(N4c5ccccc5C[C@@H]4C)[nH]c(=O)c3c2=S)cc1 |
| InChI | InChI=1S/C23H21N5OS/c1-3-15-8-10-17(11-9-15)27-13-24-20-19(22(27)30)21(29)26-23(25-20)28-14(2)12-16-6-4-5-7-18(16)28/h4-11,13-14H,3,12H2,1-2H3,(H,25,26,29)/t14-/m0/s1 |
| InChIKey | NSLQMUOZCYXSDV-AWEZNQCLSA-N |
| XLogP | 4.48 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|