C13H13MnN3O4 — CID 135995368
2-aminobenzoic acid;(Z)-3-(1H-imidazol-4-yl)prop-2-enoic acid;manganese (PubChem CID 135995368) has the molecular formula C13H13MnN3O4 and a molecular weight of 330.20 g/mol. Its IUPAC name is 2-aminobenzoic acid;(Z)-3-(1H-imidazol-4-yl)prop-2-enoic acid;manganese.
| Compound Name | 2-aminobenzoic acid;(Z)-3-(1H-imidazol-4-yl)prop-2-enoic acid;manganese |
|---|---|
| PubChem CID | 135995368 |
| Molecular Formula | C13H13MnN3O4 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-aminobenzoic acid;(Z)-3-(1H-imidazol-4-yl)prop-2-enoic acid;manganese |
| SMILES | Nc1ccccc1C(=O)O.O=C(O)/C=C\c1c[nH]cn1.[Mn] |
| InChI | InChI=1S/C7H7NO2.C6H6N2O2.Mn/c8-6-4-2-1-3-5(6)7(9)10;9-6(10)2-1-5-3-7-4-8-5;/h1-4H,8H2,(H,9,10);1-4H,(H,7,8)(H,9,10);/b;2-1-; |
| InChIKey | WEUBSCMZBOLOBH-FJOGWHKWSA-N |
| XLogP | 1.47 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|