C26H14F6N4Na2O8S2 — CID 135995389
disodium;5-[[4-hydroxy-3-(trifluoromethyl)phenyl]diazenyl]-2-[4-[[4-hydroxy-3-(trifluoromethyl)phenyl]diazenyl]-2-oxidoperoxysulfanylphenyl]benzenesulfonate (PubChem CID 135995389) has the molecular formula C26H14F6N4Na2O8S2 and a molecular weight of 734.52 g/mol. Its IUPAC name is disodium;5-[[4-hydroxy-3-(trifluoromethyl)phenyl]diazenyl]-2-[4-[[4-hydroxy-3-(trifluoromethyl)phenyl]diazenyl]-2-oxidoperoxysulfanylphenyl]benzenesulfonate.
| Compound Name | disodium;5-[[4-hydroxy-3-(trifluoromethyl)phenyl]diazenyl]-2-[4-[[4-hydroxy-3-(trifluoromethyl)phenyl]diazenyl]-2-oxidoperoxysulfanylphenyl]benzenesulfonate |
|---|---|
| PubChem CID | 135995389 |
| Molecular Formula | C26H14F6N4Na2O8S2 |
| Molecular Weight | 734.52 g/mol |
| Exact Mass | 734.00 |
| IUPAC Name | disodium;5-[[4-hydroxy-3-(trifluoromethyl)phenyl]diazenyl]-2-[4-[[4-hydroxy-3-(trifluoromethyl)phenyl]diazenyl]-2-oxidoperoxysulfanylphenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cc(/N=N/c2ccc(O)c(C(F)(F)F)c2)ccc1-c1ccc(/N=N/c2ccc(O)c(C(F)(F)F)c2)cc1SOO[O-].[Na+].[Na+] |
| InChI | InChI=1S/C26H16F6N4O8S2.2Na/c27-25(28,29)19-9-13(3-7-21(19)37)33-35-15-1-5-17(23(11-15)45-44-43-39)18-6-2-16(12-24(18)46(40,41)42)36-34-14-4-8-22(38)20(10-14)26(30,31)32;;/h1-12,37-39H,(H,40,41,42);;/q;2*+1/p-2/b35-33+,36-34+;; |
| InChIKey | QNOFMVGWLGMCCX-UUIOKUIJSA-L |
| XLogP | 1.78 |
| TPSA | 188.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|