C16H14N4O4S2 — CID 135996262
2-(3,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide (PubChem CID 135996262) has the molecular formula C16H14N4O4S2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-(3,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(3,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 135996262 |
| Molecular Formula | C16H14N4O4S2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2-(3,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide |
| SMILES | Cc1cc2c(=O)n(C)c(SCC(=O)Nc3cccc([N+](=O)[O-])c3)nc2s1 |
| InChI | InChI=1S/C16H14N4O4S2/c1-9-6-12-14(26-9)18-16(19(2)15(12)22)25-8-13(21)17-10-4-3-5-11(7-10)20(23)24/h3-7H,8H2,1-2H3,(H,17,21) |
| InChIKey | LDRPQSFZAFKJHJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|