C36H37FN6O5 — CID 135998905
1-cyclopropyl-7-[3-[2-(5-fluoro-2-hydroxy-3-phenyldiazenylindol-1-yl)ethyl-methylamino]piperidin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 135998905) has the molecular formula C36H37FN6O5 and a molecular weight of 652.73 g/mol. Its IUPAC name is 1-cyclopropyl-7-[3-[2-(5-fluoro-2-hydroxy-3-phenyldiazenylindol-1-yl)ethyl-methylamino]piperidin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-[3-[2-(5-fluoro-2-hydroxy-3-phenyldiazenylindol-1-yl)ethyl-methylamino]piperidin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 135998905 |
| Molecular Formula | C36H37FN6O5 |
| Molecular Weight | 652.73 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | 1-cyclopropyl-7-[3-[2-(5-fluoro-2-hydroxy-3-phenyldiazenylindol-1-yl)ethyl-methylamino]piperidin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCCC(N(C)CCn3c(O)c(/N=N/c4ccccc4)c4cc(F)ccc43)C2)ccc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C36H37FN6O5/c1-40(17-18-42-29-14-10-22(37)19-27(29)31(35(42)45)39-38-23-7-4-3-5-8-23)25-9-6-16-41(20-25)30-15-13-26-32(34(30)48-2)43(24-11-12-24)21-28(33(26)44)36(46)47/h3-5,7-8,10,13-15,19,21,24-25,45H,6,9,11-12,16-18,20H2,1-2H3,(H,46,47)/b39-38+ |
| InChIKey | KORDQVQYFQABMA-YMZYAJTMSA-N |
| XLogP | 6.86 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.73 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|