C21H24N2O4 — CID 143050584
1-cyclopropyl-7-(3-cyclopropylpyrrolidin-1-yl)-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 143050584) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-cyclopropyl-7-(3-cyclopropylpyrrolidin-1-yl)-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-(3-cyclopropylpyrrolidin-1-yl)-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143050584 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-cyclopropyl-7-(3-cyclopropylpyrrolidin-1-yl)-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCC(C3CC3)C2)ccc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C21H24N2O4/c1-27-20-17(22-9-8-13(10-22)12-2-3-12)7-6-15-18(20)23(14-4-5-14)11-16(19(15)24)21(25)26/h6-7,11-14H,2-5,8-10H2,1H3,(H,25,26) |
| InChIKey | OMPZNAPCCBOHDA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |