C23H24N4O7 — CID 126540260
1-cyclopropyl-8-methoxy-7-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 126540260) has the molecular formula C23H24N4O7 and a molecular weight of 468.47 g/mol. Its IUPAC name is 1-cyclopropyl-8-methoxy-7-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-8-methoxy-7-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 126540260 |
| Molecular Formula | C23H24N4O7 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-cyclopropyl-8-methoxy-7-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCN(Cc3ccc([N+](=O)[O-])o3)CC2)ccc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C23H24N4O7/c1-33-22-18(25-10-8-24(9-11-25)12-15-4-7-19(34-15)27(31)32)6-5-16-20(22)26(14-2-3-14)13-17(21(16)28)23(29)30/h4-7,13-14H,2-3,8-12H2,1H3,(H,29,30) |
| InChIKey | PPWSQFMVUBPMOW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|