C23H23FN4O7 — CID 140910512
1-cyclopropyl-6-fluoro-8-methoxy-7-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 140910512) has the molecular formula C23H23FN4O7 and a molecular weight of 486.46 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-8-methoxy-7-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-8-methoxy-7-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 140910512 |
| Molecular Formula | C23H23FN4O7 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-8-methoxy-7-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCN(Cc3ccc([N+](=O)[O-])o3)CC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C23H23FN4O7/c1-34-22-19-15(21(29)16(23(30)31)12-27(19)13-2-3-13)10-17(24)20(22)26-8-6-25(7-9-26)11-14-4-5-18(35-14)28(32)33/h4-5,10,12-13H,2-3,6-9,11H2,1H3,(H,30,31) |
| InChIKey | QBOOQYSJMZCVIN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|