C26H31N5O — CID 136500375
3-[1-[2-[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]ethyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 136500375) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is 3-[1-[2-[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]ethyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[2-[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]ethyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 136500375 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 3-[1-[2-[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]ethyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(CC/N=C2\C[C@H]3c4ccccc4CC[C@H]3N2)CC1 |
| InChI | InChI=1S/C26H31N5O/c32-26-29-23-7-3-4-8-24(23)31(26)19-11-14-30(15-12-19)16-13-27-25-17-21-20-6-2-1-5-18(20)9-10-22(21)28-25/h1-8,19,21-22H,9-17H2,(H,27,28)(H,29,32)/t21-,22+/m0/s1 |
| InChIKey | KNTQSSPFQUIPCV-FCHUYYIVSA-N |
| XLogP | 3.46 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|