About 2-ethenylquinoxalin-6-ol
2-ethenylquinoxalin-6-ol (PubChem CID 136501444) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-ethenylquinoxalin-6-ol.
Molecular Properties
| Compound Name | 2-ethenylquinoxalin-6-ol |
| PubChem CID | 136501444 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 2-ethenylquinoxalin-6-ol |
| SMILES | C=Cc1cnc2cc(O)ccc2n1 |
| InChI | InChI=1S/C10H8N2O/c1-2-7-6-11-10-5-8(13)3-4-9(10)12-7/h2-6,13H,1H2 |
| InChIKey | BKWNXHTYMUNJMA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethenylquinoxalin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylquinoxalin-6-ol?
The IUPAC name of 2-ethenylquinoxalin-6-ol (CID 136501444) is 2-ethenylquinoxalin-6-ol.
What is the SMILES notation for 2-ethenylquinoxalin-6-ol?
The canonical SMILES for 2-ethenylquinoxalin-6-ol is C=Cc1cnc2cc(O)ccc2n1.
What is the InChIKey of 2-ethenylquinoxalin-6-ol?
The InChIKey is BKWNXHTYMUNJMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c1-2-7-6-11-10-5-8(13)3-4-9(10)12-7/h2-6,13H,1H2.
What are the key properties of 2-ethenylquinoxalin-6-ol?
2-ethenylquinoxalin-6-ol has a molecular weight of 172.19 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylquinoxalin-6-ol is sourced from PubChem (CID 136501444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).