C20H20F3N6O5P — CID 136502871
1-[6-oxo-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-1H-purin-7-yl]butyl dihydrogen phosphate (PubChem CID 136502871) has the molecular formula C20H20F3N6O5P and a molecular weight of 512.39 g/mol. Its IUPAC name is 1-[6-oxo-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-1H-purin-7-yl]butyl dihydrogen phosphate.
| Compound Name | 1-[6-oxo-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-1H-purin-7-yl]butyl dihydrogen phosphate |
|---|---|
| PubChem CID | 136502871 |
| Molecular Formula | C20H20F3N6O5P |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 1-[6-oxo-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-1H-purin-7-yl]butyl dihydrogen phosphate |
| SMILES | CCCC(OP(=O)(O)O)n1c(-c2cnn(Cc3cccc(C(F)(F)F)c3)c2)nc2nc[nH]c(=O)c21 |
| InChI | InChI=1S/C20H20F3N6O5P/c1-2-4-15(34-35(31,32)33)29-16-17(24-11-25-19(16)30)27-18(29)13-8-26-28(10-13)9-12-5-3-6-14(7-12)20(21,22)23/h3,5-8,10-11,15H,2,4,9H2,1H3,(H,24,25,30)(H2,31,32,33) |
| InChIKey | VHJPUWINWOURQF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|