C5H5N5 — CID 136503629
1,5-dihydroimidazo[4,5-e][1,2,4]triazepine (PubChem CID 136503629) has the molecular formula C5H5N5 and a molecular weight of 135.13 g/mol. Its IUPAC name is 1,5-dihydroimidazo[4,5-e][1,2,4]triazepine.
| Compound Name | 1,5-dihydroimidazo[4,5-e][1,2,4]triazepine |
|---|---|
| PubChem CID | 136503629 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 1,5-dihydroimidazo[4,5-e][1,2,4]triazepine |
| SMILES | C1=c2[nH]cnc2=NCN=N1 |
| InChI | InChI=1S/C5H5N5/c1-4-5(7-2-6-4)8-3-10-9-1/h1-2H,3H2,(H,6,7,8) |
| InChIKey | DQZQHGGTXCKPOF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |