C6H4N4 — CID 176523119
2,3,8,10-tetrazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene (PubChem CID 176523119) has the molecular formula C6H4N4 and a molecular weight of 132.13 g/mol. Its IUPAC name is 2,3,8,10-tetrazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene.
| Compound Name | 2,3,8,10-tetrazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene |
|---|---|
| PubChem CID | 176523119 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 2,3,8,10-tetrazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene |
| SMILES | C1=CC=c2[nH]cnc2=NN=1 |
| InChI | InChI=1S/C6H4N4/c1-2-5-6(8-4-7-5)10-9-3-1/h1-2,4H,(H,7,8,10) |
| InChIKey | KSANQQHNHNQQCQ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |