C7H5N3 — CID 123736072
2,8,10-triazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene (PubChem CID 123736072) has the molecular formula C7H5N3 and a molecular weight of 131.14 g/mol. Its IUPAC name is 2,8,10-triazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene.
| Compound Name | 2,8,10-triazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene |
|---|---|
| PubChem CID | 123736072 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 2,8,10-triazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene |
| SMILES | C1=CC=c2[nH]cnc2=NC=1 |
| InChI | InChI=1S/C7H5N3/c1-2-4-8-7-6(3-1)9-5-10-7/h1,3-5H,(H,8,9,10) |
| InChIKey | IGNGVDDCVCDSGT-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |