C7H11N3 — CID 137220482
(5E)-N-ethyl-5-ethylidene-1H-imidazol-4-imine (PubChem CID 137220482) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is (5E)-N-ethyl-5-ethylidene-1H-imidazol-4-imine.
| Compound Name | (5E)-N-ethyl-5-ethylidene-1H-imidazol-4-imine |
|---|---|
| PubChem CID | 137220482 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (5E)-N-ethyl-5-ethylidene-1H-imidazol-4-imine |
| SMILES | C/C=C1/NC=N/C1=N\CC |
| InChI | InChI=1S/C7H11N3/c1-3-6-7(8-4-2)10-5-9-6/h3,5H,4H2,1-2H3,(H,8,9,10)/b6-3+ |
| InChIKey | BINFDRSWJWCBHO-ZZXKWVIFSA-N |
| XLogP | 0.94 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|