C9H19N3 — CID 145371011
ethane;(5E)-N-ethyl-5-ethylidene-1H-imidazol-4-imine;molecular hydrogen (PubChem CID 145371011) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;(5E)-N-ethyl-5-ethylidene-1H-imidazol-4-imine;molecular hydrogen.
| Compound Name | ethane;(5E)-N-ethyl-5-ethylidene-1H-imidazol-4-imine;molecular hydrogen |
|---|---|
| PubChem CID | 145371011 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | ethane;(5E)-N-ethyl-5-ethylidene-1H-imidazol-4-imine;molecular hydrogen |
| SMILES | C/C=C1/NC=N/C1=N\CC.CC.[H][H] |
| InChI | InChI=1S/C7H11N3.C2H6.H2/c1-3-6-7(8-4-2)10-5-9-6;1-2;/h3,5H,4H2,1-2H3,(H,8,9,10);1-2H3;1H/b6-3+;; |
| InChIKey | RNVDUAFCJJPBLH-RRHCXGJISA-N |
| XLogP | 2.21 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|