C6H11N3 — CID 145497001
N,N'-dimethyl-2-(methylideneamino)prop-2-enimidamide (PubChem CID 145497001) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is N,N'-dimethyl-2-(methylideneamino)prop-2-enimidamide.
| Compound Name | N,N'-dimethyl-2-(methylideneamino)prop-2-enimidamide |
|---|---|
| PubChem CID | 145497001 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | N,N'-dimethyl-2-(methylideneamino)prop-2-enimidamide |
| SMILES | C=NC(=C)/C(=N/C)NC |
| InChI | InChI=1S/C6H11N3/c1-5(7-2)6(8-3)9-4/h1-2H2,3-4H3,(H,8,9) |
| InChIKey | OLEPUMKBKYUQFX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|