C7H14N4 — CID 143940343
(Z)-3-amino-N,N'-dimethyl-2-(methylideneamino)but-2-enimidamide (PubChem CID 143940343) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is (Z)-3-amino-N,N'-dimethyl-2-(methylideneamino)but-2-enimidamide.
| Compound Name | (Z)-3-amino-N,N'-dimethyl-2-(methylideneamino)but-2-enimidamide |
|---|---|
| PubChem CID | 143940343 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | (Z)-3-amino-N,N'-dimethyl-2-(methylideneamino)but-2-enimidamide |
| SMILES | C=NC(/C(=N/C)NC)=C(/C)N |
| InChI | InChI=1S/C7H14N4/c1-5(8)6(9-2)7(10-3)11-4/h2,8H2,1,3-4H3,(H,10,11)/b6-5- |
| InChIKey | ZNMXNCNMHUJDNK-WAYWQWQTSA-N |
| XLogP | 0.12 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|