C8H15N3 — CID 123430551
N-ethyl-2-(ethylideneamino)-N'-methylprop-2-enimidamide (PubChem CID 123430551) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N-ethyl-2-(ethylideneamino)-N'-methylprop-2-enimidamide.
| Compound Name | N-ethyl-2-(ethylideneamino)-N'-methylprop-2-enimidamide |
|---|---|
| PubChem CID | 123430551 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-ethyl-2-(ethylideneamino)-N'-methylprop-2-enimidamide |
| SMILES | C=C(/N=C/C)/C(=N/C)NCC |
| InChI | InChI=1S/C8H15N3/c1-5-10-7(3)8(9-4)11-6-2/h5H,3,6H2,1-2,4H3,(H,9,11)/b10-5+ |
| InChIKey | WWLDVWDQTFPOLU-BJMVGYQFSA-N |
| XLogP | 1.23 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|