C7H13N3 — CID 163781501
2-(ethylideneamino)-N,N'-dimethylprop-2-enimidamide (PubChem CID 163781501) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-(ethylideneamino)-N,N'-dimethylprop-2-enimidamide.
| Compound Name | 2-(ethylideneamino)-N,N'-dimethylprop-2-enimidamide |
|---|---|
| PubChem CID | 163781501 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-(ethylideneamino)-N,N'-dimethylprop-2-enimidamide |
| SMILES | C=C(/N=C/C)/C(=N/C)NC |
| InChI | InChI=1S/C7H13N3/c1-5-10-6(2)7(8-3)9-4/h5H,2H2,1,3-4H3,(H,8,9)/b10-5+ |
| InChIKey | MOYMUAIJOAAPAJ-BJMVGYQFSA-N |
| XLogP | 0.84 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|