C8H13N3 — CID 166688955
N-ethyl-2-ethyliminopyrrol-3-amine (PubChem CID 166688955) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is N-ethyl-2-ethyliminopyrrol-3-amine.
| Compound Name | N-ethyl-2-ethyliminopyrrol-3-amine |
|---|---|
| PubChem CID | 166688955 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N-ethyl-2-ethyliminopyrrol-3-amine |
| SMILES | CC/N=C1\N=CC=C1NCC |
| InChI | InChI=1S/C8H13N3/c1-3-9-7-5-6-11-8(7)10-4-2/h5-6H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | VGHLVZWLMDVMHL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|