C7H15N3 — CID 163625764
N,N'-dimethyl-2-(prop-1-en-2-ylamino)ethanimidamide (PubChem CID 163625764) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is N,N'-dimethyl-2-(prop-1-en-2-ylamino)ethanimidamide.
| Compound Name | N,N'-dimethyl-2-(prop-1-en-2-ylamino)ethanimidamide |
|---|---|
| PubChem CID | 163625764 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | N,N'-dimethyl-2-(prop-1-en-2-ylamino)ethanimidamide |
| SMILES | C=C(C)NC/C(=N/C)NC |
| InChI | InChI=1S/C7H15N3/c1-6(2)10-5-7(8-3)9-4/h10H,1,5H2,2-4H3,(H,8,9) |
| InChIKey | HRWFDVQHPFDBMJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|