C5H9ClN2 — CID 67915380
2,4-dimethyl-1H-imidazol-1-ium chloride (PubChem CID 67915380) has the molecular formula C5H9ClN2 and a molecular weight of 132.59 g/mol. Its IUPAC name is 2,4-dimethyl-1H-imidazol-1-ium chloride.
| Compound Name | 2,4-dimethyl-1H-imidazol-1-ium chloride |
|---|---|
| PubChem CID | 67915380 |
| Molecular Formula | C5H9ClN2 |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | 2,4-dimethyl-1H-imidazol-1-ium chloride |
| SMILES | CC1=C[NH2+]C(C)=N1.[Cl-] |
| InChI | InChI=1S/C5H8N2.ClH/c1-4-3-6-5(2)7-4;/h3H,1-2H3,(H,6,7);1H |
| InChIKey | VEOGZFDBTMWPDV-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 28.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |