C8H15IN2 — CID 66764410
2,4-dimethyl-1-propyl-1H-imidazol-1-ium iodide (PubChem CID 66764410) has the molecular formula C8H15IN2 and a molecular weight of 266.13 g/mol. Its IUPAC name is 2,4-dimethyl-1-propyl-1H-imidazol-1-ium iodide.
| Compound Name | 2,4-dimethyl-1-propyl-1H-imidazol-1-ium iodide |
|---|---|
| PubChem CID | 66764410 |
| Molecular Formula | C8H15IN2 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2,4-dimethyl-1-propyl-1H-imidazol-1-ium iodide |
| SMILES | CCC[NH+]1C=C(C)N=C1C.[I-] |
| InChI | InChI=1S/C8H14N2.HI/c1-4-5-10-6-7(2)9-8(10)3;/h6H,4-5H2,1-3H3;1H |
| InChIKey | SZTSOGYCXBVMMT-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|