C11H21IN2 — CID 66987741
1-hexyl-2,4-dimethyl-1H-imidazol-1-ium iodide (PubChem CID 66987741) has the molecular formula C11H21IN2 and a molecular weight of 308.21 g/mol. Its IUPAC name is 1-hexyl-2,4-dimethyl-1H-imidazol-1-ium iodide.
| Compound Name | 1-hexyl-2,4-dimethyl-1H-imidazol-1-ium iodide |
|---|---|
| PubChem CID | 66987741 |
| Molecular Formula | C11H21IN2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-hexyl-2,4-dimethyl-1H-imidazol-1-ium iodide |
| SMILES | CCCCCC[NH+]1C=C(C)N=C1C.[I-] |
| InChI | InChI=1S/C11H20N2.HI/c1-4-5-6-7-8-13-9-10(2)12-11(13)3;/h9H,4-8H2,1-3H3;1H |
| InChIKey | JVKYQNKBSRUGAE-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|