C11H21N2+ — CID 148547557
4-hexyl-1,2-dimethyl-1H-imidazol-1-ium (PubChem CID 148547557) has the molecular formula C11H21N2+ and a molecular weight of 181.30 g/mol. Its IUPAC name is 4-hexyl-1,2-dimethyl-1H-imidazol-1-ium.
| Compound Name | 4-hexyl-1,2-dimethyl-1H-imidazol-1-ium |
|---|---|
| PubChem CID | 148547557 |
| Molecular Formula | C11H21N2+ |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.17 |
| IUPAC Name | 4-hexyl-1,2-dimethyl-1H-imidazol-1-ium |
| SMILES | CCCCCCC1=C[NH+](C)C(C)=N1 |
| InChI | InChI=1S/C11H20N2/c1-4-5-6-7-8-11-9-13(3)10(2)12-11/h9H,4-8H2,1-3H3/p+1 |
| InChIKey | GOGITIXSQMLRKW-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|