About 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide
4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide (PubChem CID 68807986) has the molecular formula C21H41BrN2
and a molecular weight of 401.48 g/mol. Its IUPAC name is 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide.
Molecular Properties
| Compound Name | 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide |
| PubChem CID | 68807986 |
| Molecular Formula | C21H41BrN2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide |
| SMILES | CCCCCCCCCCCCCCCCC1=C[NH+](C)C(C)=N1.[Br-] |
| InChI | InChI=1S/C21H40N2.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-23(3)20(2)22-21;/h19H,4-18H2,1-3H3;1H |
| InChIKey | NGLNJJAURYXXBM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide?
The IUPAC name of 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide (CID 68807986) is 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide.
What is the SMILES notation for 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide?
The canonical SMILES for 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide is CCCCCCCCCCCCCCCCC1=C[NH+](C)C(C)=N1.[Br-].
What is the InChIKey of 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide?
The InChIKey is NGLNJJAURYXXBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40N2.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-23(3)20(2)22-21;/h19H,4-18H2,1-3H3;1H.
What are the key properties of 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide?
4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide has a molecular weight of 401.48 g/mol, XLogP of 2.65, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexadecyl-1,2-dimethyl-1H-imidazol-1-ium bromide is sourced from PubChem (CID 68807986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).