C13H25N3 — CID 143882856
N'-[(8E)-8-methyl-9-(methylamino)nona-1,8-dien-2-yl]ethanimidamide (PubChem CID 143882856) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N'-[(8E)-8-methyl-9-(methylamino)nona-1,8-dien-2-yl]ethanimidamide.
| Compound Name | N'-[(8E)-8-methyl-9-(methylamino)nona-1,8-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 143882856 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N'-[(8E)-8-methyl-9-(methylamino)nona-1,8-dien-2-yl]ethanimidamide |
| SMILES | C=C(CCCCC/C(C)=C/NC)/N=C(\C)N |
| InChI | InChI=1S/C13H25N3/c1-11(10-15-4)8-6-5-7-9-12(2)16-13(3)14/h10,15H,2,5-9H2,1,3-4H3,(H2,14,16)/b11-10+ |
| InChIKey | TTXATTJBKHAHLD-ZHACJKMWSA-N |
| XLogP | 2.95 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|