C11H23IN2+2 — CID 160724520
iodanium 4-hexyl-1,2-dimethyl-1H-imidazol-1-ium (PubChem CID 160724520) has the molecular formula C11H23IN2+2 and a molecular weight of 310.22 g/mol. Its IUPAC name is iodanium 4-hexyl-1,2-dimethyl-1H-imidazol-1-ium.
| Compound Name | iodanium 4-hexyl-1,2-dimethyl-1H-imidazol-1-ium |
|---|---|
| PubChem CID | 160724520 |
| Molecular Formula | C11H23IN2+2 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | iodanium 4-hexyl-1,2-dimethyl-1H-imidazol-1-ium |
| SMILES | CCCCCCC1=C[NH+](C)C(C)=N1.[IH2+] |
| InChI | InChI=1S/C11H20N2.H2I/c1-4-5-6-7-8-11-9-13(3)10(2)12-11;/h9H,4-8H2,1-3H3;1H2/q;+1/p+1 |
| InChIKey | SBQUQZPFWQDQMZ-UHFFFAOYSA-O |
| XLogP | -1.79 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|